C19H21F2N3O2 — CID 51952919
(2S)-N-[3-(difluoromethoxy)phenyl]-4-methyl-2-phenylpiperazine-1-carboxamide (PubChem CID 51952919) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is (2S)-N-[3-(difluoromethoxy)phenyl]-4-methyl-2-phenylpiperazine-1-carboxamide.
| Compound Name | (2S)-N-[3-(difluoromethoxy)phenyl]-4-methyl-2-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 51952919 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (2S)-N-[3-(difluoromethoxy)phenyl]-4-methyl-2-phenylpiperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)Nc2cccc(OC(F)F)c2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H21F2N3O2/c1-23-10-11-24(17(13-23)14-6-3-2-4-7-14)19(25)22-15-8-5-9-16(12-15)26-18(20)21/h2-9,12,17-18H,10-11,13H2,1H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | MJZFLQYQCTVTNB-QGZVFWFLSA-N |
| XLogP | 3.81 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |