C21H23F2N3O2S — CID 8500214
N-[4-(difluoromethoxy)phenyl]-4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1-carbothioamide (PubChem CID 8500214) has the molecular formula C21H23F2N3O2S and a molecular weight of 419.50 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8500214 |
| Molecular Formula | C21H23F2N3O2S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1-carbothioamide |
| SMILES | FC(F)Oc1ccc(NC(=S)N2CCN(Cc3ccc4c(c3)CCO4)CC2)cc1 |
| InChI | InChI=1S/C21H23F2N3O2S/c22-20(23)28-18-4-2-17(3-5-18)24-21(29)26-10-8-25(9-11-26)14-15-1-6-19-16(13-15)7-12-27-19/h1-6,13,20H,7-12,14H2,(H,24,29) |
| InChIKey | SZWMLYGZJCYGJL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|