C20H21F2N3O3S — CID 1190097
4-(1,3-benzodioxol-5-ylmethyl)-N-[4-(difluoromethoxy)phenyl]piperazine-1-carbothioamide (PubChem CID 1190097) has the molecular formula C20H21F2N3O3S and a molecular weight of 421.47 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-[4-(difluoromethoxy)phenyl]piperazine-1-carbothioamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[4-(difluoromethoxy)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1190097 |
| Molecular Formula | C20H21F2N3O3S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[4-(difluoromethoxy)phenyl]piperazine-1-carbothioamide |
| SMILES | FC(F)Oc1ccc(NC(=S)N2CCN(Cc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C20H21F2N3O3S/c21-19(22)28-16-4-2-15(3-5-16)23-20(29)25-9-7-24(8-10-25)12-14-1-6-17-18(11-14)27-13-26-17/h1-6,11,19H,7-10,12-13H2,(H,23,29) |
| InChIKey | RMOBWYKOSNFICL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|