C17H17F2N3O2S2 — CID 9218517
N-[4-(difluoromethoxy)phenyl]-4-(thiophene-2-carbonyl)piperazine-1-carbothioamide (PubChem CID 9218517) has the molecular formula C17H17F2N3O2S2 and a molecular weight of 397.47 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-4-(thiophene-2-carbonyl)piperazine-1-carbothioamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-4-(thiophene-2-carbonyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 9218517 |
| Molecular Formula | C17H17F2N3O2S2 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-4-(thiophene-2-carbonyl)piperazine-1-carbothioamide |
| SMILES | O=C(c1cccs1)N1CCN(C(=S)Nc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H17F2N3O2S2/c18-16(19)24-13-5-3-12(4-6-13)20-17(25)22-9-7-21(8-10-22)15(23)14-2-1-11-26-14/h1-6,11,16H,7-10H2,(H,20,25) |
| InChIKey | PSSYMCKIXQZPJV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|