C19H28F2N4O2S — CID 8561515
N-tert-butyl-2-[4-[[4-(difluoromethoxy)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 8561515) has the molecular formula C19H28F2N4O2S and a molecular weight of 414.52 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[4-(difluoromethoxy)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[[4-(difluoromethoxy)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 8561515 |
| Molecular Formula | C19H28F2N4O2S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-tert-butyl-2-[4-[[4-(difluoromethoxy)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)CN1CCCN(C(=S)Nc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H28F2N4O2S/c1-19(2,3)23-16(26)13-24-9-4-10-25(12-11-24)18(28)22-14-5-7-15(8-6-14)27-17(20)21/h5-8,17H,4,9-13H2,1-3H3,(H,22,28)(H,23,26) |
| InChIKey | QEHNTKHYLWQYHA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|