C22H36N4OS — CID 8561480
N-tert-butyl-2-[4-[(4-butylphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 8561480) has the molecular formula C22H36N4OS and a molecular weight of 404.62 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[(4-butylphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[(4-butylphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 8561480 |
| Molecular Formula | C22H36N4OS |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | N-tert-butyl-2-[4-[(4-butylphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | CCCCc1ccc(NC(=S)N2CCCN(CC(=O)NC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C22H36N4OS/c1-5-6-8-18-9-11-19(12-10-18)23-21(28)26-14-7-13-25(15-16-26)17-20(27)24-22(2,3)4/h9-12H,5-8,13-17H2,1-4H3,(H,23,28)(H,24,27) |
| InChIKey | YLEOSMWBBVVIQD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|