C21H33N3O3 — CID 59143338
tert-butyl 4-[(4-butylphenyl)carbamoyl]-1,4-diazepane-1-carboxylate (PubChem CID 59143338) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is tert-butyl 4-[(4-butylphenyl)carbamoyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-butylphenyl)carbamoyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 59143338 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | tert-butyl 4-[(4-butylphenyl)carbamoyl]-1,4-diazepane-1-carboxylate |
| SMILES | CCCCc1ccc(NC(=O)N2CCCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O3/c1-5-6-8-17-9-11-18(12-10-17)22-19(25)23-13-7-14-24(16-15-23)20(26)27-21(2,3)4/h9-12H,5-8,13-16H2,1-4H3,(H,22,25) |
| InChIKey | CRAJUFDIWWSGMY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |