C22H28N4OS — CID 9240911
4-[(4-butylphenyl)carbamothioyl]-N-phenylpiperazine-1-carboxamide (PubChem CID 9240911) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is 4-[(4-butylphenyl)carbamothioyl]-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[(4-butylphenyl)carbamothioyl]-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 9240911 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 4-[(4-butylphenyl)carbamothioyl]-N-phenylpiperazine-1-carboxamide |
| SMILES | CCCCc1ccc(NC(=S)N2CCN(C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H28N4OS/c1-2-3-7-18-10-12-20(13-11-18)24-22(28)26-16-14-25(15-17-26)21(27)23-19-8-5-4-6-9-19/h4-6,8-13H,2-3,7,14-17H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | HYWUGECGSOATOK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|