C24H31N3O2 — CID 26776914
4-N-(4-pentylphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 26776914) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-N-(4-pentylphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(4-pentylphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 26776914 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 4-N-(4-pentylphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | CCCCCc1ccc(NC(=O)C2CCN(C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O2/c1-2-3-5-8-19-11-13-22(14-12-19)25-23(28)20-15-17-27(18-16-20)24(29)26-21-9-6-4-7-10-21/h4,6-7,9-14,20H,2-3,5,8,15-18H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | MXTASXQWGYLSIW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|