C20H23N3O4 — CID 7478742
4-N-(3-hydroxy-4-methoxyphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 7478742) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-N-(3-hydroxy-4-methoxyphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(3-hydroxy-4-methoxyphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 7478742 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-N-(3-hydroxy-4-methoxyphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C2CCN(C(=O)Nc3ccccc3)CC2)cc1O |
| InChI | InChI=1S/C20H23N3O4/c1-27-18-8-7-16(13-17(18)24)21-19(25)14-9-11-23(12-10-14)20(26)22-15-5-3-2-4-6-15/h2-8,13-14,24H,9-12H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | IBEGIVYDVINKDY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |