C23H29N3O4 — CID 25490674
1-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-4-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 25490674) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-4-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-4-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 25490674 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-4-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | COc1ccc(OC)c([C@@H](C)NC(=O)N2CCC(C(=O)Nc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H29N3O4/c1-16(20-15-19(29-2)9-10-21(20)30-3)24-23(28)26-13-11-17(12-14-26)22(27)25-18-7-5-4-6-8-18/h4-10,15-17H,11-14H2,1-3H3,(H,24,28)(H,25,27)/t16-/m1/s1 |
| InChIKey | LRRDQWVFJKTOGJ-MRXNPFEDSA-N |
| XLogP | 3.83 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |