C20H24N4O4S — CID 55363749
4-N-(4-methyl-3-sulfamoylphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 55363749) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is 4-N-(4-methyl-3-sulfamoylphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(4-methyl-3-sulfamoylphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 55363749 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-N-(4-methyl-3-sulfamoylphenyl)-1-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(C(=O)Nc3ccccc3)CC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C20H24N4O4S/c1-14-7-8-17(13-18(14)29(21,27)28)22-19(25)15-9-11-24(12-10-15)20(26)23-16-5-3-2-4-6-16/h2-8,13,15H,9-12H2,1H3,(H,22,25)(H,23,26)(H2,21,27,28) |
| InChIKey | XOGVXCHBYYZCIJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |