C19H23ClN4O5S2 — CID 39898875
N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-1-sulfamoylpiperidine-4-carboxamide (PubChem CID 39898875) has the molecular formula C19H23ClN4O5S2 and a molecular weight of 487.00 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-1-sulfamoylpiperidine-4-carboxamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-1-sulfamoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 39898875 |
| Molecular Formula | C19H23ClN4O5S2 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-1-sulfamoylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(S(N)(=O)=O)CC2)cc1S(=O)(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H23ClN4O5S2/c1-13-6-7-15(22-19(25)14-8-10-24(11-9-14)31(21,28)29)12-18(13)30(26,27)23-17-5-3-2-4-16(17)20/h2-7,12,14,23H,8-11H2,1H3,(H,22,25)(H2,21,28,29) |
| InChIKey | CGIVUTJNYSOCNL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |