C18H27N3O3S — CID 50875261
1-methyl-N-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)piperidine-4-carboxamide (PubChem CID 50875261) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-methyl-N-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-methyl-N-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50875261 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 1-methyl-N-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(C)CC2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C18H27N3O3S/c1-14-5-6-16(19-18(22)15-7-11-20(2)12-8-15)13-17(14)25(23,24)21-9-3-4-10-21/h5-6,13,15H,3-4,7-12H2,1-2H3,(H,19,22) |
| InChIKey | IEKUOQWQKAUKDN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |