C24H37N3O5S — CID 29357036
tert-butyl 4-[[3-(azepan-1-ylsulfonyl)-4-methylphenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 29357036) has the molecular formula C24H37N3O5S and a molecular weight of 479.64 g/mol. Its IUPAC name is tert-butyl 4-[[3-(azepan-1-ylsulfonyl)-4-methylphenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-(azepan-1-ylsulfonyl)-4-methylphenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 29357036 |
| Molecular Formula | C24H37N3O5S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | tert-butyl 4-[[3-(azepan-1-ylsulfonyl)-4-methylphenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)C2CCN(C(=O)OC(C)(C)C)CC2)cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C24H37N3O5S/c1-18-9-10-20(17-21(18)33(30,31)27-13-7-5-6-8-14-27)25-22(28)19-11-15-26(16-12-19)23(29)32-24(2,3)4/h9-10,17,19H,5-8,11-16H2,1-4H3,(H,25,28) |
| InChIKey | KDMNDWOJCIPUKS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |