C21H27N3O4 — CID 110613668
tert-butyl 4-[(3-methyl-2-oxo-1H-quinolin-7-yl)carbamoyl]piperidine-1-carboxylate (PubChem CID 110613668) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is tert-butyl 4-[(3-methyl-2-oxo-1H-quinolin-7-yl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-methyl-2-oxo-1H-quinolin-7-yl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110613668 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | tert-butyl 4-[(3-methyl-2-oxo-1H-quinolin-7-yl)carbamoyl]piperidine-1-carboxylate |
| SMILES | Cc1cc2ccc(NC(=O)C3CCN(C(=O)OC(C)(C)C)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C21H27N3O4/c1-13-11-15-5-6-16(12-17(15)23-18(13)25)22-19(26)14-7-9-24(10-8-14)20(27)28-21(2,3)4/h5-6,11-12,14H,7-10H2,1-4H3,(H,22,26)(H,23,25) |
| InChIKey | WIUAZZJQWKSARK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |