C22H37ClN2O — CID 162755830
N-(4-decylphenyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 162755830) has the molecular formula C22H37ClN2O and a molecular weight of 381.00 g/mol. Its IUPAC name is N-(4-decylphenyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(4-decylphenyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162755830 |
| Molecular Formula | C22H37ClN2O |
| Molecular Weight | 381.00 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | N-(4-decylphenyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | CCCCCCCCCCc1ccc(NC(=O)C2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C22H36N2O.ClH/c1-2-3-4-5-6-7-8-9-10-19-11-13-21(14-12-19)24-22(25)20-15-17-23-18-16-20;/h11-14,20,23H,2-10,15-18H2,1H3,(H,24,25);1H |
| InChIKey | XMYYTOCDRLNLBI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.00 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|