C22H33N3O2 — CID 24948113
N-(4-butylphenyl)-4-(3-cyclopropylpropanoyl)-1,4-diazepane-1-carboxamide (PubChem CID 24948113) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-(4-butylphenyl)-4-(3-cyclopropylpropanoyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-(4-butylphenyl)-4-(3-cyclopropylpropanoyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 24948113 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-(4-butylphenyl)-4-(3-cyclopropylpropanoyl)-1,4-diazepane-1-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)N2CCCN(C(=O)CCC3CC3)CC2)cc1 |
| InChI | InChI=1S/C22H33N3O2/c1-2-3-5-18-8-11-20(12-9-18)23-22(27)25-15-4-14-24(16-17-25)21(26)13-10-19-6-7-19/h8-9,11-12,19H,2-7,10,13-17H2,1H3,(H,23,27) |
| InChIKey | WXKYELNBGIZGGX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |