C18H27NO — CID 4076618
N-(4-butylphenyl)-3-cyclopentylpropanamide (PubChem CID 4076618) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is N-(4-butylphenyl)-3-cyclopentylpropanamide.
| Compound Name | N-(4-butylphenyl)-3-cyclopentylpropanamide |
|---|---|
| PubChem CID | 4076618 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-(4-butylphenyl)-3-cyclopentylpropanamide |
| SMILES | CCCCc1ccc(NC(=O)CCC2CCCC2)cc1 |
| InChI | InChI=1S/C18H27NO/c1-2-3-6-16-9-12-17(13-10-16)19-18(20)14-11-15-7-4-5-8-15/h9-10,12-13,15H,2-8,11,14H2,1H3,(H,19,20) |
| InChIKey | PKQHOAPEXRAMRP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |