C17H25N3OS — CID 8628911
(3R)-1-[(4-butylphenyl)carbamothioyl]piperidine-3-carboxamide (PubChem CID 8628911) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is (3R)-1-[(4-butylphenyl)carbamothioyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[(4-butylphenyl)carbamothioyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 8628911 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (3R)-1-[(4-butylphenyl)carbamothioyl]piperidine-3-carboxamide |
| SMILES | CCCCc1ccc(NC(=S)N2CCC[C@@H](C(N)=O)C2)cc1 |
| InChI | InChI=1S/C17H25N3OS/c1-2-3-5-13-7-9-15(10-8-13)19-17(22)20-11-4-6-14(12-20)16(18)21/h7-10,14H,2-6,11-12H2,1H3,(H2,18,21)(H,19,22)/t14-/m1/s1 |
| InChIKey | WTAHQLMWVBYBQA-CQSZACIVSA-N |
| XLogP | 2.92 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|