C19H28N4O2S — CID 9272620
1-[[(3S)-1-acetylpiperidine-3-carbonyl]amino]-3-(4-butylphenyl)thiourea (PubChem CID 9272620) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is 1-[[(3S)-1-acetylpiperidine-3-carbonyl]amino]-3-(4-butylphenyl)thiourea.
| Compound Name | 1-[[(3S)-1-acetylpiperidine-3-carbonyl]amino]-3-(4-butylphenyl)thiourea |
|---|---|
| PubChem CID | 9272620 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-[[(3S)-1-acetylpiperidine-3-carbonyl]amino]-3-(4-butylphenyl)thiourea |
| SMILES | CCCCc1ccc(NC(=S)NNC(=O)[C@H]2CCCN(C(C)=O)C2)cc1 |
| InChI | InChI=1S/C19H28N4O2S/c1-3-4-6-15-8-10-17(11-9-15)20-19(26)22-21-18(25)16-7-5-12-23(13-16)14(2)24/h8-11,16H,3-7,12-13H2,1-2H3,(H,21,25)(H2,20,22,26)/t16-/m0/s1 |
| InChIKey | FAPDYOCCSXQURZ-INIZCTEOSA-N |
| XLogP | 2.61 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|