C14H10F2O3S — CID 18175410
1-[4-(difluoromethoxy)phenyl]-3-thiophen-2-ylpropane-1,3-dione (PubChem CID 18175410) has the molecular formula C14H10F2O3S and a molecular weight of 296.29 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-thiophen-2-ylpropane-1,3-dione.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-thiophen-2-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 18175410 |
| Molecular Formula | C14H10F2O3S |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-thiophen-2-ylpropane-1,3-dione |
| SMILES | O=C(CC(=O)c1cccs1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H10F2O3S/c15-14(16)19-10-5-3-9(4-6-10)11(17)8-12(18)13-2-1-7-20-13/h1-7,14H,8H2 |
| InChIKey | WZKJGNIBTUGBLE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|