C13H9EuFO2S — CID 157335642
europium;1-(4-fluorophenyl)-3-thiophen-2-ylpropane-1,3-dione (PubChem CID 157335642) has the molecular formula C13H9EuFO2S and a molecular weight of 400.24 g/mol. Its IUPAC name is europium;1-(4-fluorophenyl)-3-thiophen-2-ylpropane-1,3-dione.
| Compound Name | europium;1-(4-fluorophenyl)-3-thiophen-2-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 157335642 |
| Molecular Formula | C13H9EuFO2S |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 400.95 |
| IUPAC Name | europium;1-(4-fluorophenyl)-3-thiophen-2-ylpropane-1,3-dione |
| SMILES | O=C(CC(=O)c1cccs1)c1ccc(F)cc1.[Eu] |
| InChI | InChI=1S/C13H9FO2S.Eu/c14-10-5-3-9(4-6-10)11(15)8-12(16)13-2-1-7-17-13;/h1-7H,8H2; |
| InChIKey | BFUPJWOEDGIXSG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|