C16H14O3S — CID 18175606
1-(4-prop-2-enoxyphenyl)-3-thiophen-2-ylpropane-1,3-dione (PubChem CID 18175606) has the molecular formula C16H14O3S and a molecular weight of 286.35 g/mol. Its IUPAC name is 1-(4-prop-2-enoxyphenyl)-3-thiophen-2-ylpropane-1,3-dione.
| Compound Name | 1-(4-prop-2-enoxyphenyl)-3-thiophen-2-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 18175606 |
| Molecular Formula | C16H14O3S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-(4-prop-2-enoxyphenyl)-3-thiophen-2-ylpropane-1,3-dione |
| SMILES | C=CCOc1ccc(C(=O)CC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C16H14O3S/c1-2-9-19-13-7-5-12(6-8-13)14(17)11-15(18)16-4-3-10-20-16/h2-8,10H,1,9,11H2 |
| InChIKey | YPYWWLGFEUEBDV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|