C8H6O4S — CID 2771674
2,4-dioxo-4-thiophen-2-ylbutanoic acid (PubChem CID 2771674) has the molecular formula C8H6O4S and a molecular weight of 198.20 g/mol. Its IUPAC name is 2,4-dioxo-4-thiophen-2-ylbutanoic acid.
| Compound Name | 2,4-dioxo-4-thiophen-2-ylbutanoic acid |
|---|---|
| PubChem CID | 2771674 |
| Molecular Formula | C8H6O4S |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 2,4-dioxo-4-thiophen-2-ylbutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cccs1 |
| InChI | InChI=1S/C8H6O4S/c9-5(4-6(10)8(11)12)7-2-1-3-13-7/h1-3H,4H2,(H,11,12) |
| InChIKey | MWRKICQKTVHQBI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|