C12H12O2S2 — CID 89352857
(Z)-4-methylidene-7-sulfanyl-1-thiophen-2-ylhept-6-ene-1,3-dione (PubChem CID 89352857) has the molecular formula C12H12O2S2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (Z)-4-methylidene-7-sulfanyl-1-thiophen-2-ylhept-6-ene-1,3-dione.
| Compound Name | (Z)-4-methylidene-7-sulfanyl-1-thiophen-2-ylhept-6-ene-1,3-dione |
|---|---|
| PubChem CID | 89352857 |
| Molecular Formula | C12H12O2S2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | (Z)-4-methylidene-7-sulfanyl-1-thiophen-2-ylhept-6-ene-1,3-dione |
| SMILES | C=C(C/C=C\S)C(=O)CC(=O)c1cccs1 |
| InChI | InChI=1S/C12H12O2S2/c1-9(4-2-6-15)10(13)8-11(14)12-5-3-7-16-12/h2-3,5-7,15H,1,4,8H2/b6-2- |
| InChIKey | GMNAXRFCZBHKSL-KXFIGUGUSA-N |
| XLogP | 3.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|