C14H13F2N3O3S — CID 75621361
2-[[amino(thiophen-2-yl)methylidene]amino]oxy-N-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 75621361) has the molecular formula C14H13F2N3O3S and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-[[amino(thiophen-2-yl)methylidene]amino]oxy-N-[4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[[amino(thiophen-2-yl)methylidene]amino]oxy-N-[4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 75621361 |
| Molecular Formula | C14H13F2N3O3S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-[[amino(thiophen-2-yl)methylidene]amino]oxy-N-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | NC(=NOCC(=O)Nc1ccc(OC(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C14H13F2N3O3S/c15-14(16)22-10-5-3-9(4-6-10)18-12(20)8-21-19-13(17)11-2-1-7-23-11/h1-7,14H,8H2,(H2,17,19)(H,18,20) |
| InChIKey | GNPSXBCBZIPUSP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|