C17H17F2N3OS — CID 2986425
N-(3,5-difluorophenyl)-4-(2-hydroxyphenyl)piperazine-1-carbothioamide (PubChem CID 2986425) has the molecular formula C17H17F2N3OS and a molecular weight of 349.41 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-4-(2-hydroxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-(3,5-difluorophenyl)-4-(2-hydroxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2986425 |
| Molecular Formula | C17H17F2N3OS |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(3,5-difluorophenyl)-4-(2-hydroxyphenyl)piperazine-1-carbothioamide |
| SMILES | Oc1ccccc1N1CCN(C(=S)Nc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C17H17F2N3OS/c18-12-9-13(19)11-14(10-12)20-17(24)22-7-5-21(6-8-22)15-3-1-2-4-16(15)23/h1-4,9-11,23H,5-8H2,(H,20,24) |
| InChIKey | UPHPMKDXHNDKHV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|