C17H26N4O2S — CID 8627121
4-(2-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)piperazine-1-carbothioamide (PubChem CID 8627121) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8627121 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 4-(2-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)piperazine-1-carbothioamide |
| SMILES | Oc1ccccc1N1CCN(C(=S)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C17H26N4O2S/c22-16-4-2-1-3-15(16)20-7-9-21(10-8-20)17(24)18-5-6-19-11-13-23-14-12-19/h1-4,22H,5-14H2,(H,18,24) |
| InChIKey | QXJBDJNLXYUPCQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 51.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|