C23H39N5O2S — CID 143170295
ethane;N-(2-morpholin-4-ylethyl)-4-[3-(1,2-oxazolidin-2-ylmethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 143170295) has the molecular formula C23H39N5O2S and a molecular weight of 449.67 g/mol. Its IUPAC name is ethane;N-(2-morpholin-4-ylethyl)-4-[3-(1,2-oxazolidin-2-ylmethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | ethane;N-(2-morpholin-4-ylethyl)-4-[3-(1,2-oxazolidin-2-ylmethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 143170295 |
| Molecular Formula | C23H39N5O2S |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | ethane;N-(2-morpholin-4-ylethyl)-4-[3-(1,2-oxazolidin-2-ylmethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | CC.S=C(NCCN1CCOCC1)N1CCN(c2cccc(CN3CCCO3)c2)CC1 |
| InChI | InChI=1S/C21H33N5O2S.C2H6/c29-21(22-5-7-23-12-15-27-16-13-23)25-10-8-24(9-11-25)20-4-1-3-19(17-20)18-26-6-2-14-28-26;1-2/h1,3-4,17H,2,5-16,18H2,(H,22,29);1-2H3 |
| InChIKey | HPBNULNKXUJTIA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|