C21H33N5O2S — CID 9215225
N-(2,3-dimethylphenyl)-2-[4-(2-morpholin-4-ylethylcarbamothioyl)piperazin-1-yl]acetamide (PubChem CID 9215225) has the molecular formula C21H33N5O2S and a molecular weight of 419.60 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-(2-morpholin-4-ylethylcarbamothioyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-(2-morpholin-4-ylethylcarbamothioyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9215225 |
| Molecular Formula | C21H33N5O2S |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-(2-morpholin-4-ylethylcarbamothioyl)piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2CCN(C(=S)NCCN3CCOCC3)CC2)c1C |
| InChI | InChI=1S/C21H33N5O2S/c1-17-4-3-5-19(18(17)2)23-20(27)16-25-8-10-26(11-9-25)21(29)22-6-7-24-12-14-28-15-13-24/h3-5H,6-16H2,1-2H3,(H,22,29)(H,23,27) |
| InChIKey | WDQGZAWRIZKFTP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|