C22H28N4O2S — CID 9215269
N-(2,3-dimethylphenyl)-2-[4-[(3-methoxyphenyl)carbamothioyl]piperazin-1-yl]acetamide (PubChem CID 9215269) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-[(3-methoxyphenyl)carbamothioyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-[(3-methoxyphenyl)carbamothioyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9215269 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-[(3-methoxyphenyl)carbamothioyl]piperazin-1-yl]acetamide |
| SMILES | COc1cccc(NC(=S)N2CCN(CC(=O)Nc3cccc(C)c3C)CC2)c1 |
| InChI | InChI=1S/C22H28N4O2S/c1-16-6-4-9-20(17(16)2)24-21(27)15-25-10-12-26(13-11-25)22(29)23-18-7-5-8-19(14-18)28-3/h4-9,14H,10-13,15H2,1-3H3,(H,23,29)(H,24,27) |
| InChIKey | SHTZWEJXHFHGAJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|