C17H26ClN4OS+ — CID 8626825
4-(2-chlorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)piperazine-1-carbothioamide (PubChem CID 8626825) has the molecular formula C17H26ClN4OS+ and a molecular weight of 369.94 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2-chlorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8626825 |
| Molecular Formula | C17H26ClN4OS+ |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-(2-chlorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)piperazine-1-carbothioamide |
| SMILES | S=C(NCC[NH+]1CCOCC1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H25ClN4OS/c18-15-3-1-2-4-16(15)21-7-9-22(10-8-21)17(24)19-5-6-20-11-13-23-14-12-20/h1-4H,5-14H2,(H,19,24)/p+1 |
| InChIKey | CMUJTXOIXOPVHX-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 32.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|