C19H31N4O3S2+ — CID 8743184
4-(2,4-dimethylphenyl)sulfonyl-N-(2-morpholin-4-ium-4-ylethyl)piperazine-1-carbothioamide (PubChem CID 8743184) has the molecular formula C19H31N4O3S2+ and a molecular weight of 427.62 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)sulfonyl-N-(2-morpholin-4-ium-4-ylethyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2,4-dimethylphenyl)sulfonyl-N-(2-morpholin-4-ium-4-ylethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8743184 |
| Molecular Formula | C19H31N4O3S2+ |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-(2,4-dimethylphenyl)sulfonyl-N-(2-morpholin-4-ium-4-ylethyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=S)NCC[NH+]3CCOCC3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H30N4O3S2/c1-16-3-4-18(17(2)15-16)28(24,25)23-9-7-22(8-10-23)19(27)20-5-6-21-11-13-26-14-12-21/h3-4,15H,5-14H2,1-2H3,(H,20,27)/p+1 |
| InChIKey | WKUFVPADPVXHGY-UHFFFAOYSA-O |
| XLogP | -0.60 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|