C20H25N3O3S2 — CID 8659772
4-(2,4-dimethylphenyl)sulfonyl-N-(3-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 8659772) has the molecular formula C20H25N3O3S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)sulfonyl-N-(3-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2,4-dimethylphenyl)sulfonyl-N-(3-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8659772 |
| Molecular Formula | C20H25N3O3S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 4-(2,4-dimethylphenyl)sulfonyl-N-(3-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1cccc(NC(=S)N2CCN(S(=O)(=O)c3ccc(C)cc3C)CC2)c1 |
| InChI | InChI=1S/C20H25N3O3S2/c1-15-7-8-19(16(2)13-15)28(24,25)23-11-9-22(10-12-23)20(27)21-17-5-4-6-18(14-17)26-3/h4-8,13-14H,9-12H2,1-3H3,(H,21,27) |
| InChIKey | GZSNMPBTRYGYQE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|