C20H25N3O2S2 — CID 8659773
4-(2,4-dimethylphenyl)sulfonyl-N-(3-methylphenyl)piperazine-1-carbothioamide (PubChem CID 8659773) has the molecular formula C20H25N3O2S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)sulfonyl-N-(3-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2,4-dimethylphenyl)sulfonyl-N-(3-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8659773 |
| Molecular Formula | C20H25N3O2S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 4-(2,4-dimethylphenyl)sulfonyl-N-(3-methylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1cccc(NC(=S)N2CCN(S(=O)(=O)c3ccc(C)cc3C)CC2)c1 |
| InChI | InChI=1S/C20H25N3O2S2/c1-15-5-4-6-18(14-15)21-20(26)22-9-11-23(12-10-22)27(24,25)19-8-7-16(2)13-17(19)3/h4-8,13-14H,9-12H2,1-3H3,(H,21,26) |
| InChIKey | QYJSEEDJZRKNSU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|