C17H25ClN3O5S+ — CID 7150357
4-chloro-N-(2-morpholin-4-ium-4-ylethyl)-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 7150357) has the molecular formula C17H25ClN3O5S+ and a molecular weight of 418.92 g/mol. Its IUPAC name is 4-chloro-N-(2-morpholin-4-ium-4-ylethyl)-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(2-morpholin-4-ium-4-ylethyl)-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 7150357 |
| Molecular Formula | C17H25ClN3O5S+ |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 4-chloro-N-(2-morpholin-4-ium-4-ylethyl)-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NCC[NH+]1CCOCC1)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H24ClN3O5S/c18-15-2-1-14(17(22)19-3-4-20-5-9-25-10-6-20)13-16(15)27(23,24)21-7-11-26-12-8-21/h1-2,13H,3-12H2,(H,19,22)/p+1 |
| InChIKey | AMADVSLBSYFFQS-UHFFFAOYSA-O |
| XLogP | -0.99 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |