C21H24Cl2N2O4S — CID 60583878
N-[3-(3,4-dichlorophenyl)propyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 60583878) has the molecular formula C21H24Cl2N2O4S and a molecular weight of 471.41 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 60583878 |
| Molecular Formula | C21H24Cl2N2O4S |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCCc2ccc(Cl)c(Cl)c2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H24Cl2N2O4S/c1-15-4-6-17(14-20(15)30(27,28)25-9-11-29-12-10-25)21(26)24-8-2-3-16-5-7-18(22)19(23)13-16/h4-7,13-14H,2-3,8-12H2,1H3,(H,24,26) |
| InChIKey | DQRNCJJQGXYOLX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|