C20H21Cl2FN2O4S2 — CID 126335825
4-chloro-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 126335825) has the molecular formula C20H21Cl2FN2O4S2 and a molecular weight of 507.44 g/mol. Its IUPAC name is 4-chloro-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 126335825 |
| Molecular Formula | C20H21Cl2FN2O4S2 |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | 4-chloro-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NCCSCc1c(F)cccc1Cl)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H21Cl2FN2O4S2/c21-16-2-1-3-18(23)15(16)13-30-11-6-24-20(26)14-4-5-17(22)19(12-14)31(27,28)25-7-9-29-10-8-25/h1-5,12H,6-11,13H2,(H,24,26) |
| InChIKey | HLSMMBLCBVGFMC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|