C23H28ClN3O5S — CID 46349202
N-[2-(2-chlorophenyl)ethyl]-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 46349202) has the molecular formula C23H28ClN3O5S and a molecular weight of 494.01 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)ethyl]-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[2-(2-chlorophenyl)ethyl]-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46349202 |
| Molecular Formula | C23H28ClN3O5S |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | N-[2-(2-chlorophenyl)ethyl]-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NCCc1ccccc1Cl)c1ccc(N2CCOCC2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C23H28ClN3O5S/c24-20-4-2-1-3-18(20)7-8-25-23(28)19-5-6-21(26-9-13-31-14-10-26)22(17-19)33(29,30)27-11-15-32-16-12-27/h1-6,17H,7-16H2,(H,25,28) |
| InChIKey | CDNOENLIWQEOTN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |