C23H29N3O5S — CID 46349179
N-[(4-methylphenyl)methyl]-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 46349179) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[(4-methylphenyl)methyl]-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46349179 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc(N3CCOCC3)c(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C23H29N3O5S/c1-18-2-4-19(5-3-18)17-24-23(27)20-6-7-21(25-8-12-30-13-9-25)22(16-20)32(28,29)26-10-14-31-15-11-26/h2-7,16H,8-15,17H2,1H3,(H,24,27) |
| InChIKey | VRQYFWJKTWZHEI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |