C26H41N3O5S — CID 143465360
N-(2-cyclopentyl-2-methylpentan-3-yl)-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 143465360) has the molecular formula C26H41N3O5S and a molecular weight of 507.70 g/mol. Its IUPAC name is N-(2-cyclopentyl-2-methylpentan-3-yl)-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2-cyclopentyl-2-methylpentan-3-yl)-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 143465360 |
| Molecular Formula | C26H41N3O5S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | N-(2-cyclopentyl-2-methylpentan-3-yl)-4-morpholin-4-yl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCC(NC(=O)c1ccc(N2CCOCC2)c(S(=O)(=O)N2CCOCC2)c1)C(C)(C)C1CCCC1 |
| InChI | InChI=1S/C26H41N3O5S/c1-4-24(26(2,3)21-7-5-6-8-21)27-25(30)20-9-10-22(28-11-15-33-16-12-28)23(19-20)35(31,32)29-13-17-34-18-14-29/h9-10,19,21,24H,4-8,11-18H2,1-3H3,(H,27,30) |
| InChIKey | WDKNNWUQOGBQIU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |