C24H27N3O5S — CID 20965247
N-(furan-2-ylmethyl)-4-[(4-methylphenyl)methylamino]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 20965247) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[(4-methylphenyl)methylamino]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[(4-methylphenyl)methylamino]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 20965247 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[(4-methylphenyl)methylamino]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1ccc(CNc2ccc(C(=O)NCc3ccco3)cc2S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H27N3O5S/c1-18-4-6-19(7-5-18)16-25-22-9-8-20(24(28)26-17-21-3-2-12-32-21)15-23(22)33(29,30)27-10-13-31-14-11-27/h2-9,12,15,25H,10-11,13-14,16-17H2,1H3,(H,26,28) |
| InChIKey | LFDBJKJSPIIXSB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |