C23H22ClN3O6S — CID 2207960
4-chloro-N-[2-(furan-2-ylmethylcarbamoyl)phenyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 2207960) has the molecular formula C23H22ClN3O6S and a molecular weight of 503.96 g/mol. Its IUPAC name is 4-chloro-N-[2-(furan-2-ylmethylcarbamoyl)phenyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[2-(furan-2-ylmethylcarbamoyl)phenyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2207960 |
| Molecular Formula | C23H22ClN3O6S |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 4-chloro-N-[2-(furan-2-ylmethylcarbamoyl)phenyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCc1ccco1)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C23H22ClN3O6S/c24-19-8-7-16(14-21(19)34(30,31)27-9-12-32-13-10-27)22(28)26-20-6-2-1-5-18(20)23(29)25-15-17-4-3-11-33-17/h1-8,11,14H,9-10,12-13,15H2,(H,25,29)(H,26,28) |
| InChIKey | XIKWBARQLORQBY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |