C26H22ClN3O5S — CID 4234401
4-chloro-N-[2-(furan-2-ylmethylcarbamoyl)phenyl]-3-[(2-methylphenyl)sulfamoyl]benzamide (PubChem CID 4234401) has the molecular formula C26H22ClN3O5S and a molecular weight of 524.00 g/mol. Its IUPAC name is 4-chloro-N-[2-(furan-2-ylmethylcarbamoyl)phenyl]-3-[(2-methylphenyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-[2-(furan-2-ylmethylcarbamoyl)phenyl]-3-[(2-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4234401 |
| Molecular Formula | C26H22ClN3O5S |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 4-chloro-N-[2-(furan-2-ylmethylcarbamoyl)phenyl]-3-[(2-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1cc(C(=O)Nc2ccccc2C(=O)NCc2ccco2)ccc1Cl |
| InChI | InChI=1S/C26H22ClN3O5S/c1-17-7-2-4-10-22(17)30-36(33,34)24-15-18(12-13-21(24)27)25(31)29-23-11-5-3-9-20(23)26(32)28-16-19-8-6-14-35-19/h2-15,30H,16H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | BHXFGPNARDUDKX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |