C26H28ClN3O4S — CID 126415159
N-[2-(butylcarbamoyl)phenyl]-4-chloro-3-[(2,5-dimethylphenyl)sulfamoyl]benzamide (PubChem CID 126415159) has the molecular formula C26H28ClN3O4S and a molecular weight of 514.05 g/mol. Its IUPAC name is N-[2-(butylcarbamoyl)phenyl]-4-chloro-3-[(2,5-dimethylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(butylcarbamoyl)phenyl]-4-chloro-3-[(2,5-dimethylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 126415159 |
| Molecular Formula | C26H28ClN3O4S |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | N-[2-(butylcarbamoyl)phenyl]-4-chloro-3-[(2,5-dimethylphenyl)sulfamoyl]benzamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)c1ccc(Cl)c(S(=O)(=O)Nc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C26H28ClN3O4S/c1-4-5-14-28-26(32)20-8-6-7-9-22(20)29-25(31)19-12-13-21(27)24(16-19)35(33,34)30-23-15-17(2)10-11-18(23)3/h6-13,15-16,30H,4-5,14H2,1-3H3,(H,28,32)(H,29,31) |
| InChIKey | QKVYOFWPVFOBBG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|