C23H22ClN3O4S — CID 25247329
N-(3-acetamidophenyl)-4-chloro-3-[(2,5-dimethylphenyl)sulfamoyl]benzamide (PubChem CID 25247329) has the molecular formula C23H22ClN3O4S and a molecular weight of 471.97 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-4-chloro-3-[(2,5-dimethylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(3-acetamidophenyl)-4-chloro-3-[(2,5-dimethylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 25247329 |
| Molecular Formula | C23H22ClN3O4S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | N-(3-acetamidophenyl)-4-chloro-3-[(2,5-dimethylphenyl)sulfamoyl]benzamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)Nc3cc(C)ccc3C)c2)c1 |
| InChI | InChI=1S/C23H22ClN3O4S/c1-14-7-8-15(2)21(11-14)27-32(30,31)22-12-17(9-10-20(22)24)23(29)26-19-6-4-5-18(13-19)25-16(3)28/h4-13,27H,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | XUCZGIBSNILYOY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |