C19H18F4N2O5S — CID 24646597
4-fluoro-3-morpholin-4-ylsulfonyl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 24646597) has the molecular formula C19H18F4N2O5S and a molecular weight of 462.42 g/mol. Its IUPAC name is 4-fluoro-3-morpholin-4-ylsulfonyl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 4-fluoro-3-morpholin-4-ylsulfonyl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 24646597 |
| Molecular Formula | C19H18F4N2O5S |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 4-fluoro-3-morpholin-4-ylsulfonyl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(OC(F)(F)F)cc1)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H18F4N2O5S/c20-16-6-3-14(11-17(16)31(27,28)25-7-9-29-10-8-25)18(26)24-12-13-1-4-15(5-2-13)30-19(21,22)23/h1-6,11H,7-10,12H2,(H,24,26) |
| InChIKey | DURQWSMAGWSPQI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |