C18H29N4O2S+ — CID 8620576
4-(4-hydroxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)piperazine-1-carbothioamide (PubChem CID 8620576) has the molecular formula C18H29N4O2S+ and a molecular weight of 365.52 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)piperazine-1-carbothioamide.
| Compound Name | 4-(4-hydroxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8620576 |
| Molecular Formula | C18H29N4O2S+ |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-(4-hydroxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)piperazine-1-carbothioamide |
| SMILES | Oc1ccc(N2CCN(C(=S)NCCC[NH+]3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C18H28N4O2S/c23-17-4-2-16(3-5-17)21-8-10-22(11-9-21)18(25)19-6-1-7-20-12-14-24-15-13-20/h2-5,23H,1,6-15H2,(H,19,25)/p+1 |
| InChIKey | JARCSPPEMYSABE-UHFFFAOYSA-O |
| XLogP | -0.31 |
| TPSA | 52.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|