C20H29N4OS2+ — CID 8679137
(3S)-3-(1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ium-4-ylpropyl)piperidine-1-carbothioamide (PubChem CID 8679137) has the molecular formula C20H29N4OS2+ and a molecular weight of 405.61 g/mol. Its IUPAC name is (3S)-3-(1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ium-4-ylpropyl)piperidine-1-carbothioamide.
| Compound Name | (3S)-3-(1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ium-4-ylpropyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 8679137 |
| Molecular Formula | C20H29N4OS2+ |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (3S)-3-(1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ium-4-ylpropyl)piperidine-1-carbothioamide |
| SMILES | S=C(NCCC[NH+]1CCOCC1)N1CCC[C@H](c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C20H28N4OS2/c26-20(21-8-4-9-23-11-13-25-14-12-23)24-10-3-5-16(15-24)19-22-17-6-1-2-7-18(17)27-19/h1-2,6-7,16H,3-5,8-15H2,(H,21,26)/p+1/t16-/m0/s1 |
| InChIKey | ZMRZUAUYUQQACP-INIZCTEOSA-O |
| XLogP | 1.66 |
| TPSA | 41.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|